C14H17F3O — CID 105093857
(4,4-difluorocyclohexyl)-(4-fluoro-2-methylphenyl)methanol (PubChem CID 105093857) has the molecular formula C14H17F3O and a molecular weight of 258.28 g/mol. Its IUPAC name is (4,4-difluorocyclohexyl)-(4-fluoro-2-methylphenyl)methanol.
| Compound Name | (4,4-difluorocyclohexyl)-(4-fluoro-2-methylphenyl)methanol |
|---|---|
| PubChem CID | 105093857 |
| Molecular Formula | C14H17F3O |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | (4,4-difluorocyclohexyl)-(4-fluoro-2-methylphenyl)methanol |
| SMILES | Cc1cc(F)ccc1C(O)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C14H17F3O/c1-9-8-11(15)2-3-12(9)13(18)10-4-6-14(16,17)7-5-10/h2-3,8,10,13,18H,4-7H2,1H3 |
| InChIKey | SHCWCMILYJSOPQ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |