C15H19NO2 — CID 105094595
4-ethoxy-1-isoquinolin-5-ylbutan-1-ol (PubChem CID 105094595) has the molecular formula C15H19NO2 and a molecular weight of 245.32 g/mol. Its IUPAC name is 4-ethoxy-1-isoquinolin-5-ylbutan-1-ol.
| Compound Name | 4-ethoxy-1-isoquinolin-5-ylbutan-1-ol |
|---|---|
| PubChem CID | 105094595 |
| Molecular Formula | C15H19NO2 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | 4-ethoxy-1-isoquinolin-5-ylbutan-1-ol |
| SMILES | CCOCCCC(O)c1cccc2cnccc12 |
| InChI | InChI=1S/C15H19NO2/c1-2-18-10-4-7-15(17)14-6-3-5-12-11-16-9-8-13(12)14/h3,5-6,8-9,11,15,17H,2,4,7,10H2,1H3 |
| InChIKey | UWHNNJFPCZRDGC-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|