C9H4F2N2OS — CID 105095106
(3,5-difluorophenyl)-(thiadiazol-5-yl)methanone (PubChem CID 105095106) has the molecular formula C9H4F2N2OS and a molecular weight of 226.21 g/mol. Its IUPAC name is (3,5-difluorophenyl)-(thiadiazol-5-yl)methanone.
| Compound Name | (3,5-difluorophenyl)-(thiadiazol-5-yl)methanone |
|---|---|
| PubChem CID | 105095106 |
| Molecular Formula | C9H4F2N2OS |
| Molecular Weight | 226.21 g/mol |
| Exact Mass | 226.00 |
| IUPAC Name | (3,5-difluorophenyl)-(thiadiazol-5-yl)methanone |
| SMILES | O=C(c1cc(F)cc(F)c1)c1cnns1 |
| InChI | InChI=1S/C9H4F2N2OS/c10-6-1-5(2-7(11)3-6)9(14)8-4-12-13-15-8/h1-4H |
| InChIKey | KDYAHMQWGBCPCD-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.21 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |