C13H10F3NO — CID 105097054
(2-methyl-3-pyridinyl)-(2,3,4-trifluorophenyl)methanol (PubChem CID 105097054) has the molecular formula C13H10F3NO and a molecular weight of 253.22 g/mol. Its IUPAC name is (2-methyl-3-pyridinyl)-(2,3,4-trifluorophenyl)methanol.
| Compound Name | (2-methyl-3-pyridinyl)-(2,3,4-trifluorophenyl)methanol |
|---|---|
| PubChem CID | 105097054 |
| Molecular Formula | C13H10F3NO |
| Molecular Weight | 253.22 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | (2-methyl-3-pyridinyl)-(2,3,4-trifluorophenyl)methanol |
| SMILES | Cc1ncccc1C(O)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C13H10F3NO/c1-7-8(3-2-6-17-7)13(18)9-4-5-10(14)12(16)11(9)15/h2-6,13,18H,1H3 |
| InChIKey | WYLVMKZTGDRHDE-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.22 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|