C15H15FN2OS — CID 105098016
(5-fluoro-1-benzothiophen-2-yl)-(2-propylpyrazol-3-yl)methanol (PubChem CID 105098016) has the molecular formula C15H15FN2OS and a molecular weight of 290.36 g/mol. Its IUPAC name is (5-fluoro-1-benzothiophen-2-yl)-(2-propylpyrazol-3-yl)methanol.
| Compound Name | (5-fluoro-1-benzothiophen-2-yl)-(2-propylpyrazol-3-yl)methanol |
|---|---|
| PubChem CID | 105098016 |
| Molecular Formula | C15H15FN2OS |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | (5-fluoro-1-benzothiophen-2-yl)-(2-propylpyrazol-3-yl)methanol |
| SMILES | CCCn1nccc1C(O)c1cc2cc(F)ccc2s1 |
| InChI | InChI=1S/C15H15FN2OS/c1-2-7-18-12(5-6-17-18)15(19)14-9-10-8-11(16)3-4-13(10)20-14/h3-6,8-9,15,19H,2,7H2,1H3 |
| InChIKey | XIZXXNKOXOEZIM-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |