C12H22N2O2 — CID 105098448
3-propoxy-1-(1-propylimidazol-2-yl)propan-1-ol (PubChem CID 105098448) has the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. Its IUPAC name is 3-propoxy-1-(1-propylimidazol-2-yl)propan-1-ol.
| Compound Name | 3-propoxy-1-(1-propylimidazol-2-yl)propan-1-ol |
|---|---|
| PubChem CID | 105098448 |
| Molecular Formula | C12H22N2O2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | 3-propoxy-1-(1-propylimidazol-2-yl)propan-1-ol |
| SMILES | CCCOCCC(O)c1nccn1CCC |
| InChI | InChI=1S/C12H22N2O2/c1-3-7-14-8-6-13-12(14)11(15)5-10-16-9-4-2/h6,8,11,15H,3-5,7,9-10H2,1-2H3 |
| InChIKey | VIEHJJLXUWAWSB-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|