About (2-methyl-1,3-thiazol-4-yl)-(oxolan-3-yl)methanone
(2-methyl-1,3-thiazol-4-yl)-(oxolan-3-yl)methanone (PubChem CID 105099777) has the molecular formula C9H11NO2S
and a molecular weight of 197.26 g/mol. Its IUPAC name is (2-methyl-1,3-thiazol-4-yl)-(oxolan-3-yl)methanone.
Molecular Properties
| Compound Name | (2-methyl-1,3-thiazol-4-yl)-(oxolan-3-yl)methanone |
| PubChem CID | 105099777 |
| Molecular Formula | C9H11NO2S |
| Molecular Weight | 197.26 g/mol |
| Exact Mass | 197.05 |
| IUPAC Name | (2-methyl-1,3-thiazol-4-yl)-(oxolan-3-yl)methanone |
| SMILES | Cc1nc(C(=O)C2CCOC2)cs1 |
| InChI | InChI=1S/C9H11NO2S/c1-6-10-8(5-13-6)9(11)7-2-3-12-4-7/h5,7H,2-4H2,1H3 |
| InChIKey | CQETVHBBUDAXGQ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.26 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2-methyl-1,3-thiazol-4-yl)-(oxolan-3-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methyl-1,3-thiazol-4-yl)-(oxolan-3-yl)methanone?
The IUPAC name of (2-methyl-1,3-thiazol-4-yl)-(oxolan-3-yl)methanone (CID 105099777) is (2-methyl-1,3-thiazol-4-yl)-(oxolan-3-yl)methanone.
What is the SMILES notation for (2-methyl-1,3-thiazol-4-yl)-(oxolan-3-yl)methanone?
The canonical SMILES for (2-methyl-1,3-thiazol-4-yl)-(oxolan-3-yl)methanone is Cc1nc(C(=O)C2CCOC2)cs1.
What is the InChIKey of (2-methyl-1,3-thiazol-4-yl)-(oxolan-3-yl)methanone?
The InChIKey is CQETVHBBUDAXGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO2S/c1-6-10-8(5-13-6)9(11)7-2-3-12-4-7/h5,7H,2-4H2,1H3.
What are the key properties of (2-methyl-1,3-thiazol-4-yl)-(oxolan-3-yl)methanone?
(2-methyl-1,3-thiazol-4-yl)-(oxolan-3-yl)methanone has a molecular weight of 197.26 g/mol, XLogP of 1.67, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methyl-1,3-thiazol-4-yl)-(oxolan-3-yl)methanone is sourced from PubChem (CID 105099777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).