C17H15ClFNS — CID 105099912
N-[(2-chlorophenyl)-(5-fluoro-1-benzothiophen-2-yl)methyl]ethanamine (PubChem CID 105099912) has the molecular formula C17H15ClFNS and a molecular weight of 319.83 g/mol. Its IUPAC name is N-[(2-chlorophenyl)-(5-fluoro-1-benzothiophen-2-yl)methyl]ethanamine.
| Compound Name | N-[(2-chlorophenyl)-(5-fluoro-1-benzothiophen-2-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 105099912 |
| Molecular Formula | C17H15ClFNS |
| Molecular Weight | 319.83 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | N-[(2-chlorophenyl)-(5-fluoro-1-benzothiophen-2-yl)methyl]ethanamine |
| SMILES | CCNC(c1cc2cc(F)ccc2s1)c1ccccc1Cl |
| InChI | InChI=1S/C17H15ClFNS/c1-2-20-17(13-5-3-4-6-14(13)18)16-10-11-9-12(19)7-8-15(11)21-16/h3-10,17,20H,2H2,1H3 |
| InChIKey | QKSRVBVJIPBNEI-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.83 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |