C11H15N3S — CID 105100495
(2-ethyl-5-methylpyrazol-3-yl)-thiophen-2-ylmethanamine (PubChem CID 105100495) has the molecular formula C11H15N3S and a molecular weight of 221.33 g/mol. Its IUPAC name is (2-ethyl-5-methylpyrazol-3-yl)-thiophen-2-ylmethanamine.
| Compound Name | (2-ethyl-5-methylpyrazol-3-yl)-thiophen-2-ylmethanamine |
|---|---|
| PubChem CID | 105100495 |
| Molecular Formula | C11H15N3S |
| Molecular Weight | 221.33 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | (2-ethyl-5-methylpyrazol-3-yl)-thiophen-2-ylmethanamine |
| SMILES | CCn1nc(C)cc1C(N)c1cccs1 |
| InChI | InChI=1S/C11H15N3S/c1-3-14-9(7-8(2)13-14)11(12)10-5-4-6-15-10/h4-7,11H,3,12H2,1-2H3 |
| InChIKey | XWMDQHWAQOMTJS-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.33 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |