C14H17IN2O — CID 105101093
2-(4-iodophenyl)-1-(1,3,5-trimethylpyrazol-4-yl)ethanol (PubChem CID 105101093) has the molecular formula C14H17IN2O and a molecular weight of 356.21 g/mol. Its IUPAC name is 2-(4-iodophenyl)-1-(1,3,5-trimethylpyrazol-4-yl)ethanol.
| Compound Name | 2-(4-iodophenyl)-1-(1,3,5-trimethylpyrazol-4-yl)ethanol |
|---|---|
| PubChem CID | 105101093 |
| Molecular Formula | C14H17IN2O |
| Molecular Weight | 356.21 g/mol |
| Exact Mass | 356.04 |
| IUPAC Name | 2-(4-iodophenyl)-1-(1,3,5-trimethylpyrazol-4-yl)ethanol |
| SMILES | Cc1nn(C)c(C)c1C(O)Cc1ccc(I)cc1 |
| InChI | InChI=1S/C14H17IN2O/c1-9-14(10(2)17(3)16-9)13(18)8-11-4-6-12(15)7-5-11/h4-7,13,18H,8H2,1-3H3 |
| InChIKey | BNUMKJPCYKICJK-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.21 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|