C14H23NO — CID 105101467
1-(4-ethylphenyl)-3-propan-2-yloxypropan-2-amine (PubChem CID 105101467) has the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. Its IUPAC name is 1-(4-ethylphenyl)-3-propan-2-yloxypropan-2-amine.
| Compound Name | 1-(4-ethylphenyl)-3-propan-2-yloxypropan-2-amine |
|---|---|
| PubChem CID | 105101467 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | 1-(4-ethylphenyl)-3-propan-2-yloxypropan-2-amine |
| SMILES | CCc1ccc(CC(N)COC(C)C)cc1 |
| InChI | InChI=1S/C14H23NO/c1-4-12-5-7-13(8-6-12)9-14(15)10-16-11(2)3/h5-8,11,14H,4,9-10,15H2,1-3H3 |
| InChIKey | OAUSYCMTSWYQLY-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |