C15H26N2O — CID 105102592
(1,3-diethylpyrazol-5-yl)-(4-methylcyclohexyl)methanol (PubChem CID 105102592) has the molecular formula C15H26N2O and a molecular weight of 250.39 g/mol. Its IUPAC name is (1,3-diethylpyrazol-5-yl)-(4-methylcyclohexyl)methanol.
| Compound Name | (1,3-diethylpyrazol-5-yl)-(4-methylcyclohexyl)methanol |
|---|---|
| PubChem CID | 105102592 |
| Molecular Formula | C15H26N2O |
| Molecular Weight | 250.39 g/mol |
| Exact Mass | 250.20 |
| IUPAC Name | (1,3-diethylpyrazol-5-yl)-(4-methylcyclohexyl)methanol |
| SMILES | CCc1cc(C(O)C2CCC(C)CC2)n(CC)n1 |
| InChI | InChI=1S/C15H26N2O/c1-4-13-10-14(17(5-2)16-13)15(18)12-8-6-11(3)7-9-12/h10-12,15,18H,4-9H2,1-3H3 |
| InChIKey | YSGPVTQSIOMLAK-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.39 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |