C11H13FN4S — CID 105102650
(5-fluoro-3-pyridinyl)-(4-propylthiadiazol-5-yl)methanamine (PubChem CID 105102650) has the molecular formula C11H13FN4S and a molecular weight of 252.32 g/mol. Its IUPAC name is (5-fluoro-3-pyridinyl)-(4-propylthiadiazol-5-yl)methanamine.
| Compound Name | (5-fluoro-3-pyridinyl)-(4-propylthiadiazol-5-yl)methanamine |
|---|---|
| PubChem CID | 105102650 |
| Molecular Formula | C11H13FN4S |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | (5-fluoro-3-pyridinyl)-(4-propylthiadiazol-5-yl)methanamine |
| SMILES | CCCc1nnsc1C(N)c1cncc(F)c1 |
| InChI | InChI=1S/C11H13FN4S/c1-2-3-9-11(17-16-15-9)10(13)7-4-8(12)6-14-5-7/h4-6,10H,2-3,13H2,1H3 |
| InChIKey | LVDJMPKGHYCCGA-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |