C17H35NS — CID 105103395
N,4-diethyl-1-(thian-4-yl)octan-2-amine (PubChem CID 105103395) has the molecular formula C17H35NS and a molecular weight of 285.54 g/mol. Its IUPAC name is N,4-diethyl-1-(thian-4-yl)octan-2-amine.
| Compound Name | N,4-diethyl-1-(thian-4-yl)octan-2-amine |
|---|---|
| PubChem CID | 105103395 |
| Molecular Formula | C17H35NS |
| Molecular Weight | 285.54 g/mol |
| Exact Mass | 285.25 |
| IUPAC Name | N,4-diethyl-1-(thian-4-yl)octan-2-amine |
| SMILES | CCCCC(CC)CC(CC1CCSCC1)NCC |
| InChI | InChI=1S/C17H35NS/c1-4-7-8-15(5-2)13-17(18-6-3)14-16-9-11-19-12-10-16/h15-18H,4-14H2,1-3H3 |
| InChIKey | PCDPYDJPCFIRSM-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.54 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |