C15H24F3N3 — CID 105104088
N-methyl-1-(1-propylpyrazol-4-yl)-1-[4-(trifluoromethyl)cyclohexyl]methanamine (PubChem CID 105104088) has the molecular formula C15H24F3N3 and a molecular weight of 303.37 g/mol. Its IUPAC name is N-methyl-1-(1-propylpyrazol-4-yl)-1-[4-(trifluoromethyl)cyclohexyl]methanamine.
| Compound Name | N-methyl-1-(1-propylpyrazol-4-yl)-1-[4-(trifluoromethyl)cyclohexyl]methanamine |
|---|---|
| PubChem CID | 105104088 |
| Molecular Formula | C15H24F3N3 |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | N-methyl-1-(1-propylpyrazol-4-yl)-1-[4-(trifluoromethyl)cyclohexyl]methanamine |
| SMILES | CCCn1cc(C(NC)C2CCC(C(F)(F)F)CC2)cn1 |
| InChI | InChI=1S/C15H24F3N3/c1-3-8-21-10-12(9-20-21)14(19-2)11-4-6-13(7-5-11)15(16,17)18/h9-11,13-14,19H,3-8H2,1-2H3 |
| InChIKey | KWYDSNHGBINJAU-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |