C17H20F2N2 — CID 105105357
1-(2,5-difluorophenyl)-N-ethyl-4-pyridin-3-ylbutan-2-amine (PubChem CID 105105357) has the molecular formula C17H20F2N2 and a molecular weight of 290.36 g/mol. Its IUPAC name is 1-(2,5-difluorophenyl)-N-ethyl-4-pyridin-3-ylbutan-2-amine.
| Compound Name | 1-(2,5-difluorophenyl)-N-ethyl-4-pyridin-3-ylbutan-2-amine |
|---|---|
| PubChem CID | 105105357 |
| Molecular Formula | C17H20F2N2 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | 1-(2,5-difluorophenyl)-N-ethyl-4-pyridin-3-ylbutan-2-amine |
| SMILES | CCNC(CCc1cccnc1)Cc1cc(F)ccc1F |
| InChI | InChI=1S/C17H20F2N2/c1-2-21-16(7-5-13-4-3-9-20-12-13)11-14-10-15(18)6-8-17(14)19/h3-4,6,8-10,12,16,21H,2,5,7,11H2,1H3 |
| InChIKey | QAFOMTIHKCIBQS-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |