C12H12N2OS — CID 105105851
thiadiazol-4-yl-(2,4,5-trimethylphenyl)methanone (PubChem CID 105105851) has the molecular formula C12H12N2OS and a molecular weight of 232.31 g/mol. Its IUPAC name is thiadiazol-4-yl-(2,4,5-trimethylphenyl)methanone.
| Compound Name | thiadiazol-4-yl-(2,4,5-trimethylphenyl)methanone |
|---|---|
| PubChem CID | 105105851 |
| Molecular Formula | C12H12N2OS |
| Molecular Weight | 232.31 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | thiadiazol-4-yl-(2,4,5-trimethylphenyl)methanone |
| SMILES | Cc1cc(C)c(C(=O)c2csnn2)cc1C |
| InChI | InChI=1S/C12H12N2OS/c1-7-4-9(3)10(5-8(7)2)12(15)11-6-16-14-13-11/h4-6H,1-3H3 |
| InChIKey | HFFYPBJHQMIIOS-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.31 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |