C10H11F3N2O — CID 105106819
1-(3,6-dimethylpyridazin-4-yl)-4,4,4-trifluorobutan-1-one (PubChem CID 105106819) has the molecular formula C10H11F3N2O and a molecular weight of 232.20 g/mol. Its IUPAC name is 1-(3,6-dimethylpyridazin-4-yl)-4,4,4-trifluorobutan-1-one.
| Compound Name | 1-(3,6-dimethylpyridazin-4-yl)-4,4,4-trifluorobutan-1-one |
|---|---|
| PubChem CID | 105106819 |
| Molecular Formula | C10H11F3N2O |
| Molecular Weight | 232.20 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | 1-(3,6-dimethylpyridazin-4-yl)-4,4,4-trifluorobutan-1-one |
| SMILES | Cc1cc(C(=O)CCC(F)(F)F)c(C)nn1 |
| InChI | InChI=1S/C10H11F3N2O/c1-6-5-8(7(2)15-14-6)9(16)3-4-10(11,12)13/h5H,3-4H2,1-2H3 |
| InChIKey | XZXZJSQQZQPBCE-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.20 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |