C12H10O2 — CID 105108198
1-(3,4-dihydro-1H-isochromen-1-yl)prop-2-yn-1-one (PubChem CID 105108198) has the molecular formula C12H10O2 and a molecular weight of 186.21 g/mol. Its IUPAC name is 1-(3,4-dihydro-1H-isochromen-1-yl)prop-2-yn-1-one.
| Compound Name | 1-(3,4-dihydro-1H-isochromen-1-yl)prop-2-yn-1-one |
|---|---|
| PubChem CID | 105108198 |
| Molecular Formula | C12H10O2 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.07 |
| IUPAC Name | 1-(3,4-dihydro-1H-isochromen-1-yl)prop-2-yn-1-one |
| SMILES | C#CC(=O)C1OCCc2ccccc21 |
| InChI | InChI=1S/C12H10O2/c1-2-11(13)12-10-6-4-3-5-9(10)7-8-14-12/h1,3-6,12H,7-8H2 |
| InChIKey | XYIZVGQQJSNCMS-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|