C7H9NO2 — CID 10510925
(3S,3aR,6aR)-3-amino-3,3a,4,6a-tetrahydrocyclopenta[b]furan-2-one (PubChem CID 10510925) has the molecular formula C7H9NO2 and a molecular weight of 139.15 g/mol. Its IUPAC name is (3S,3aR,6aR)-3-amino-3,3a,4,6a-tetrahydrocyclopenta[b]furan-2-one.
| Compound Name | (3S,3aR,6aR)-3-amino-3,3a,4,6a-tetrahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 10510925 |
| Molecular Formula | C7H9NO2 |
| Molecular Weight | 139.15 g/mol |
| Exact Mass | 139.06 |
| IUPAC Name | (3S,3aR,6aR)-3-amino-3,3a,4,6a-tetrahydrocyclopenta[b]furan-2-one |
| SMILES | N[C@@H]1C(=O)O[C@@H]2C=CC[C@H]12 |
| InChI | InChI=1S/C7H9NO2/c8-6-4-2-1-3-5(4)10-7(6)9/h1,3-6H,2,8H2/t4-,5+,6-/m0/s1 |
| InChIKey | FOYAMRCAKRZJQQ-JKUQZMGJSA-N |
| XLogP | -0.18 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.15 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|