About (4R,5S)-5-ethenyl-4,5-dimethyloxolan-2-ol
(4R,5S)-5-ethenyl-4,5-dimethyloxolan-2-ol (PubChem CID 10510958) has the molecular formula C8H14O2
and a molecular weight of 142.20 g/mol. Its IUPAC name is (4R,5S)-5-ethenyl-4,5-dimethyloxolan-2-ol.
Molecular Properties
| Compound Name | (4R,5S)-5-ethenyl-4,5-dimethyloxolan-2-ol |
| PubChem CID | 10510958 |
| Molecular Formula | C8H14O2 |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.10 |
| IUPAC Name | (4R,5S)-5-ethenyl-4,5-dimethyloxolan-2-ol |
| SMILES | C=C[C@]1(C)OC(O)C[C@H]1C |
| InChI | InChI=1S/C8H14O2/c1-4-8(3)6(2)5-7(9)10-8/h4,6-7,9H,1,5H2,2-3H3/t6-,7?,8+/m1/s1 |
| InChIKey | JULBPFOKNLHYNV-QUFPSDLASA-N |
| XLogP | 1.31 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4R,5S)-5-ethenyl-4,5-dimethyloxolan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R,5S)-5-ethenyl-4,5-dimethyloxolan-2-ol?
The IUPAC name of (4R,5S)-5-ethenyl-4,5-dimethyloxolan-2-ol (CID 10510958) is (4R,5S)-5-ethenyl-4,5-dimethyloxolan-2-ol.
What is the SMILES notation for (4R,5S)-5-ethenyl-4,5-dimethyloxolan-2-ol?
The canonical SMILES for (4R,5S)-5-ethenyl-4,5-dimethyloxolan-2-ol is C=C[C@]1(C)OC(O)C[C@H]1C.
What is the InChIKey of (4R,5S)-5-ethenyl-4,5-dimethyloxolan-2-ol?
The InChIKey is JULBPFOKNLHYNV-QUFPSDLASA-N. The full InChI is InChI=1S/C8H14O2/c1-4-8(3)6(2)5-7(9)10-8/h4,6-7,9H,1,5H2,2-3H3/t6-,7?,8+/m1/s1.
What are the key properties of (4R,5S)-5-ethenyl-4,5-dimethyloxolan-2-ol?
(4R,5S)-5-ethenyl-4,5-dimethyloxolan-2-ol has a molecular weight of 142.20 g/mol, XLogP of 1.31, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4R,5S)-5-ethenyl-4,5-dimethyloxolan-2-ol is sourced from PubChem (CID 10510958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).