About 5-methyl-4-methylsulfanyl-1,2-oxazol-3-one
5-methyl-4-methylsulfanyl-1,2-oxazol-3-one (PubChem CID 10510972) has the molecular formula C5H7NO2S
and a molecular weight of 145.18 g/mol. Its IUPAC name is 5-methyl-4-methylsulfanyl-1,2-oxazol-3-one.
Molecular Properties
| Compound Name | 5-methyl-4-methylsulfanyl-1,2-oxazol-3-one |
| PubChem CID | 10510972 |
| Molecular Formula | C5H7NO2S |
| Molecular Weight | 145.18 g/mol |
| Exact Mass | 145.02 |
| IUPAC Name | 5-methyl-4-methylsulfanyl-1,2-oxazol-3-one |
| SMILES | CSc1c(C)o[nH]c1=O |
| InChI | InChI=1S/C5H7NO2S/c1-3-4(9-2)5(7)6-8-3/h1-2H3,(H,6,7) |
| InChIKey | YKZIMVZCMNUSCE-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 46.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.18 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-methyl-4-methylsulfanyl-1,2-oxazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-4-methylsulfanyl-1,2-oxazol-3-one?
The IUPAC name of 5-methyl-4-methylsulfanyl-1,2-oxazol-3-one (CID 10510972) is 5-methyl-4-methylsulfanyl-1,2-oxazol-3-one.
What is the SMILES notation for 5-methyl-4-methylsulfanyl-1,2-oxazol-3-one?
The canonical SMILES for 5-methyl-4-methylsulfanyl-1,2-oxazol-3-one is CSc1c(C)o[nH]c1=O.
What is the InChIKey of 5-methyl-4-methylsulfanyl-1,2-oxazol-3-one?
The InChIKey is YKZIMVZCMNUSCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7NO2S/c1-3-4(9-2)5(7)6-8-3/h1-2H3,(H,6,7).
What are the key properties of 5-methyl-4-methylsulfanyl-1,2-oxazol-3-one?
5-methyl-4-methylsulfanyl-1,2-oxazol-3-one has a molecular weight of 145.18 g/mol, XLogP of 1.00, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-4-methylsulfanyl-1,2-oxazol-3-one is sourced from PubChem (CID 10510972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).