About 2-pyridin-3-ylpropanoic acid
2-pyridin-3-ylpropanoic acid (PubChem CID 10511017) has the molecular formula C8H9NO2
and a molecular weight of 151.16 g/mol. Its IUPAC name is 2-pyridin-3-ylpropanoic acid.
Molecular Properties
| Compound Name | 2-pyridin-3-ylpropanoic acid |
| PubChem CID | 10511017 |
| Molecular Formula | C8H9NO2 |
| Molecular Weight | 151.16 g/mol |
| Exact Mass | 151.06 |
| IUPAC Name | 2-pyridin-3-ylpropanoic acid |
| SMILES | CC(C(=O)O)c1cccnc1 |
| InChI | InChI=1S/C8H9NO2/c1-6(8(10)11)7-3-2-4-9-5-7/h2-6H,1H3,(H,10,11) |
| InChIKey | RVSGAPGURIPIFA-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.16 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-pyridin-3-ylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyridin-3-ylpropanoic acid?
The IUPAC name of 2-pyridin-3-ylpropanoic acid (CID 10511017) is 2-pyridin-3-ylpropanoic acid.
What is the SMILES notation for 2-pyridin-3-ylpropanoic acid?
The canonical SMILES for 2-pyridin-3-ylpropanoic acid is CC(C(=O)O)c1cccnc1.
What is the InChIKey of 2-pyridin-3-ylpropanoic acid?
The InChIKey is RVSGAPGURIPIFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO2/c1-6(8(10)11)7-3-2-4-9-5-7/h2-6H,1H3,(H,10,11).
What are the key properties of 2-pyridin-3-ylpropanoic acid?
2-pyridin-3-ylpropanoic acid has a molecular weight of 151.16 g/mol, XLogP of 1.27, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyridin-3-ylpropanoic acid is sourced from PubChem (CID 10511017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).