C17H23N3O — CID 105110644
1-[2-(2-methylpropyl)-1,2,4-triazol-3-yl]-5-phenylpentan-2-one (PubChem CID 105110644) has the molecular formula C17H23N3O and a molecular weight of 285.39 g/mol. Its IUPAC name is 1-[2-(2-methylpropyl)-1,2,4-triazol-3-yl]-5-phenylpentan-2-one.
| Compound Name | 1-[2-(2-methylpropyl)-1,2,4-triazol-3-yl]-5-phenylpentan-2-one |
|---|---|
| PubChem CID | 105110644 |
| Molecular Formula | C17H23N3O |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.18 |
| IUPAC Name | 1-[2-(2-methylpropyl)-1,2,4-triazol-3-yl]-5-phenylpentan-2-one |
| SMILES | CC(C)Cn1ncnc1CC(=O)CCCc1ccccc1 |
| InChI | InChI=1S/C17H23N3O/c1-14(2)12-20-17(18-13-19-20)11-16(21)10-6-9-15-7-4-3-5-8-15/h3-5,7-8,13-14H,6,9-12H2,1-2H3 |
| InChIKey | RKYHRHVRXYTWFI-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |