C9H10N2O — CID 105110928
1-(3,6-dimethylpyridazin-4-yl)prop-2-en-1-one (PubChem CID 105110928) has the molecular formula C9H10N2O and a molecular weight of 162.19 g/mol. Its IUPAC name is 1-(3,6-dimethylpyridazin-4-yl)prop-2-en-1-one.
| Compound Name | 1-(3,6-dimethylpyridazin-4-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 105110928 |
| Molecular Formula | C9H10N2O |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.08 |
| IUPAC Name | 1-(3,6-dimethylpyridazin-4-yl)prop-2-en-1-one |
| SMILES | C=CC(=O)c1cc(C)nnc1C |
| InChI | InChI=1S/C9H10N2O/c1-4-9(12)8-5-6(2)10-11-7(8)3/h4-5H,1H2,2-3H3 |
| InChIKey | SJKVYDKZJXDYPU-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|