C12H15ClO2S — CID 105111122
(4-chloro-3-methoxyphenyl)-(thiolan-3-yl)methanol (PubChem CID 105111122) has the molecular formula C12H15ClO2S and a molecular weight of 258.77 g/mol. Its IUPAC name is (4-chloro-3-methoxyphenyl)-(thiolan-3-yl)methanol.
| Compound Name | (4-chloro-3-methoxyphenyl)-(thiolan-3-yl)methanol |
|---|---|
| PubChem CID | 105111122 |
| Molecular Formula | C12H15ClO2S |
| Molecular Weight | 258.77 g/mol |
| Exact Mass | 258.05 |
| IUPAC Name | (4-chloro-3-methoxyphenyl)-(thiolan-3-yl)methanol |
| SMILES | COc1cc(C(O)C2CCSC2)ccc1Cl |
| InChI | InChI=1S/C12H15ClO2S/c1-15-11-6-8(2-3-10(11)13)12(14)9-4-5-16-7-9/h2-3,6,9,12,14H,4-5,7H2,1H3 |
| InChIKey | SCELMVZCLVAVBU-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.77 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |