C15H19BrFN3S — CID 105111357
2-(3-bromo-4-fluorophenyl)-N-ethyl-1-(4-propylthiadiazol-5-yl)ethanamine (PubChem CID 105111357) has the molecular formula C15H19BrFN3S and a molecular weight of 372.31 g/mol. Its IUPAC name is 2-(3-bromo-4-fluorophenyl)-N-ethyl-1-(4-propylthiadiazol-5-yl)ethanamine.
| Compound Name | 2-(3-bromo-4-fluorophenyl)-N-ethyl-1-(4-propylthiadiazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 105111357 |
| Molecular Formula | C15H19BrFN3S |
| Molecular Weight | 372.31 g/mol |
| Exact Mass | 371.05 |
| IUPAC Name | 2-(3-bromo-4-fluorophenyl)-N-ethyl-1-(4-propylthiadiazol-5-yl)ethanamine |
| SMILES | CCCc1nnsc1C(Cc1ccc(F)c(Br)c1)NCC |
| InChI | InChI=1S/C15H19BrFN3S/c1-3-5-13-15(21-20-19-13)14(18-4-2)9-10-6-7-12(17)11(16)8-10/h6-8,14,18H,3-5,9H2,1-2H3 |
| InChIKey | KTTZLHAMIOWXJM-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.31 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |