C11H18N2O2 — CID 105111769
2-ethoxy-1-(3-ethyl-6-methylpyridazin-4-yl)ethanol (PubChem CID 105111769) has the molecular formula C11H18N2O2 and a molecular weight of 210.28 g/mol. Its IUPAC name is 2-ethoxy-1-(3-ethyl-6-methylpyridazin-4-yl)ethanol.
| Compound Name | 2-ethoxy-1-(3-ethyl-6-methylpyridazin-4-yl)ethanol |
|---|---|
| PubChem CID | 105111769 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 2-ethoxy-1-(3-ethyl-6-methylpyridazin-4-yl)ethanol |
| SMILES | CCOCC(O)c1cc(C)nnc1CC |
| InChI | InChI=1S/C11H18N2O2/c1-4-10-9(6-8(3)12-13-10)11(14)7-15-5-2/h6,11,14H,4-5,7H2,1-3H3 |
| InChIKey | MXIPCKGHTXGRQN-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |