C12H16O4 — CID 105111843
1-(2,3-dihydro-1,4-benzodioxin-5-yl)-2-ethoxyethanol (PubChem CID 105111843) has the molecular formula C12H16O4 and a molecular weight of 224.26 g/mol. Its IUPAC name is 1-(2,3-dihydro-1,4-benzodioxin-5-yl)-2-ethoxyethanol.
| Compound Name | 1-(2,3-dihydro-1,4-benzodioxin-5-yl)-2-ethoxyethanol |
|---|---|
| PubChem CID | 105111843 |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | 1-(2,3-dihydro-1,4-benzodioxin-5-yl)-2-ethoxyethanol |
| SMILES | CCOCC(O)c1cccc2c1OCCO2 |
| InChI | InChI=1S/C12H16O4/c1-2-14-8-10(13)9-4-3-5-11-12(9)16-7-6-15-11/h3-5,10,13H,2,6-8H2,1H3 |
| InChIKey | LNXQLXCQTSCWEZ-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |