About 2-(2-fluorophenyl)furan
2-(2-fluorophenyl)furan (PubChem CID 10511186) has the molecular formula C10H7FO
and a molecular weight of 162.16 g/mol. Its IUPAC name is 2-(2-fluorophenyl)furan.
Molecular Properties
| Compound Name | 2-(2-fluorophenyl)furan |
| PubChem CID | 10511186 |
| Molecular Formula | C10H7FO |
| Molecular Weight | 162.16 g/mol |
| Exact Mass | 162.05 |
| IUPAC Name | 2-(2-fluorophenyl)furan |
| SMILES | Fc1ccccc1-c1ccco1 |
| InChI | InChI=1S/C10H7FO/c11-9-5-2-1-4-8(9)10-6-3-7-12-10/h1-7H |
| InChIKey | YSRWMGLEZPVXHD-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.16 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(2-fluorophenyl)furan with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-fluorophenyl)furan?
The IUPAC name of 2-(2-fluorophenyl)furan (CID 10511186) is 2-(2-fluorophenyl)furan.
What is the SMILES notation for 2-(2-fluorophenyl)furan?
The canonical SMILES for 2-(2-fluorophenyl)furan is Fc1ccccc1-c1ccco1.
What is the InChIKey of 2-(2-fluorophenyl)furan?
The InChIKey is YSRWMGLEZPVXHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7FO/c11-9-5-2-1-4-8(9)10-6-3-7-12-10/h1-7H.
What are the key properties of 2-(2-fluorophenyl)furan?
2-(2-fluorophenyl)furan has a molecular weight of 162.16 g/mol, XLogP of 3.09, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-fluorophenyl)furan is sourced from PubChem (CID 10511186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).