About 1,2-dichlorocycloheptene
1,2-dichlorocycloheptene (PubChem CID 10511230) has the molecular formula C7H10Cl2
and a molecular weight of 165.06 g/mol. Its IUPAC name is 1,2-dichlorocycloheptene.
Molecular Properties
| Compound Name | 1,2-dichlorocycloheptene |
| PubChem CID | 10511230 |
| Molecular Formula | C7H10Cl2 |
| Molecular Weight | 165.06 g/mol |
| Exact Mass | 164.02 |
| IUPAC Name | 1,2-dichlorocycloheptene |
| SMILES | ClC1=C(Cl)CCCCC1 |
| InChI | InChI=1S/C7H10Cl2/c8-6-4-2-1-3-5-7(6)9/h1-5H2 |
| InChIKey | YWTYLGXZMFRHLF-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.06 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,2-dichlorocycloheptene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dichlorocycloheptene?
The IUPAC name of 1,2-dichlorocycloheptene (CID 10511230) is 1,2-dichlorocycloheptene.
What is the SMILES notation for 1,2-dichlorocycloheptene?
The canonical SMILES for 1,2-dichlorocycloheptene is ClC1=C(Cl)CCCCC1.
What is the InChIKey of 1,2-dichlorocycloheptene?
The InChIKey is YWTYLGXZMFRHLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10Cl2/c8-6-4-2-1-3-5-7(6)9/h1-5H2.
What are the key properties of 1,2-dichlorocycloheptene?
1,2-dichlorocycloheptene has a molecular weight of 165.06 g/mol, XLogP of 3.64, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dichlorocycloheptene is sourced from PubChem (CID 10511230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).