About 3-[(5-bromo-1,3-thiazol-2-yl)sulfamoyl]-4,5-difluorobenzoic acid
3-[(5-bromo-1,3-thiazol-2-yl)sulfamoyl]-4,5-difluorobenzoic acid (PubChem CID 105112964) has the molecular formula C10H5BrF2N2O4S2
and a molecular weight of 399.19 g/mol. Its IUPAC name is 3-[(5-bromo-1,3-thiazol-2-yl)sulfamoyl]-4,5-difluorobenzoic acid.
Molecular Properties
| Compound Name | 3-[(5-bromo-1,3-thiazol-2-yl)sulfamoyl]-4,5-difluorobenzoic acid |
| PubChem CID | 105112964 |
| Molecular Formula | C10H5BrF2N2O4S2 |
| Molecular Weight | 399.19 g/mol |
| Exact Mass | 397.88 |
| IUPAC Name | 3-[(5-bromo-1,3-thiazol-2-yl)sulfamoyl]-4,5-difluorobenzoic acid |
| SMILES | O=C(O)c1cc(F)c(F)c(S(=O)(=O)Nc2ncc(Br)s2)c1 |
| InChI | InChI=1S/C10H5BrF2N2O4S2/c11-7-3-14-10(20-7)15-21(18,19)6-2-4(9(16)17)1-5(12)8(6)13/h1-3H,(H,14,15)(H,16,17) |
| InChIKey | JWBOWJBIWUQACU-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.19 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[(5-bromo-1,3-thiazol-2-yl)sulfamoyl]-4,5-difluorobenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(5-bromo-1,3-thiazol-2-yl)sulfamoyl]-4,5-difluorobenzoic acid?
The IUPAC name of 3-[(5-bromo-1,3-thiazol-2-yl)sulfamoyl]-4,5-difluorobenzoic acid (CID 105112964) is 3-[(5-bromo-1,3-thiazol-2-yl)sulfamoyl]-4,5-difluorobenzoic acid.
What is the SMILES notation for 3-[(5-bromo-1,3-thiazol-2-yl)sulfamoyl]-4,5-difluorobenzoic acid?
The canonical SMILES for 3-[(5-bromo-1,3-thiazol-2-yl)sulfamoyl]-4,5-difluorobenzoic acid is O=C(O)c1cc(F)c(F)c(S(=O)(=O)Nc2ncc(Br)s2)c1.
What is the InChIKey of 3-[(5-bromo-1,3-thiazol-2-yl)sulfamoyl]-4,5-difluorobenzoic acid?
The InChIKey is JWBOWJBIWUQACU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H5BrF2N2O4S2/c11-7-3-14-10(20-7)15-21(18,19)6-2-4(9(16)17)1-5(12)8(6)13/h1-3H,(H,14,15)(H,16,17).
What are the key properties of 3-[(5-bromo-1,3-thiazol-2-yl)sulfamoyl]-4,5-difluorobenzoic acid?
3-[(5-bromo-1,3-thiazol-2-yl)sulfamoyl]-4,5-difluorobenzoic acid has a molecular weight of 399.19 g/mol, XLogP of 2.68, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(5-bromo-1,3-thiazol-2-yl)sulfamoyl]-4,5-difluorobenzoic acid is sourced from PubChem (CID 105112964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).