C12H22F3NO2S — CID 105113301
4-methylsulfonyl-1-[2-(trifluoromethyl)cyclohexyl]butan-1-amine (PubChem CID 105113301) has the molecular formula C12H22F3NO2S and a molecular weight of 301.37 g/mol. Its IUPAC name is 4-methylsulfonyl-1-[2-(trifluoromethyl)cyclohexyl]butan-1-amine.
| Compound Name | 4-methylsulfonyl-1-[2-(trifluoromethyl)cyclohexyl]butan-1-amine |
|---|---|
| PubChem CID | 105113301 |
| Molecular Formula | C12H22F3NO2S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 4-methylsulfonyl-1-[2-(trifluoromethyl)cyclohexyl]butan-1-amine |
| SMILES | CS(=O)(=O)CCCC(N)C1CCCCC1C(F)(F)F |
| InChI | InChI=1S/C12H22F3NO2S/c1-19(17,18)8-4-7-11(16)9-5-2-3-6-10(9)12(13,14)15/h9-11H,2-8,16H2,1H3 |
| InChIKey | UUDDBPRJNZILQU-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |