About (2R)-2-(3,4-dihydro-2H-pyrrol-5-ylamino)-N-methylpropanamide
(2R)-2-(3,4-dihydro-2H-pyrrol-5-ylamino)-N-methylpropanamide (PubChem CID 10511338) has the molecular formula C8H15N3O
and a molecular weight of 169.23 g/mol. Its IUPAC name is (2R)-2-(3,4-dihydro-2H-pyrrol-5-ylamino)-N-methylpropanamide.
Molecular Properties
| Compound Name | (2R)-2-(3,4-dihydro-2H-pyrrol-5-ylamino)-N-methylpropanamide |
| PubChem CID | 10511338 |
| Molecular Formula | C8H15N3O |
| Molecular Weight | 169.23 g/mol |
| Exact Mass | 169.12 |
| IUPAC Name | (2R)-2-(3,4-dihydro-2H-pyrrol-5-ylamino)-N-methylpropanamide |
| SMILES | CNC(=O)[C@@H](C)NC1=NCCC1 |
| InChI | InChI=1S/C8H15N3O/c1-6(8(12)9-2)11-7-4-3-5-10-7/h6H,3-5H2,1-2H3,(H,9,12)(H,10,11)/t6-/m1/s1 |
| InChIKey | KFUMJFUGRPZNAQ-ZCFIWIBFSA-N |
| XLogP | -0.10 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.23 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R)-2-(3,4-dihydro-2H-pyrrol-5-ylamino)-N-methylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-(3,4-dihydro-2H-pyrrol-5-ylamino)-N-methylpropanamide?
The IUPAC name of (2R)-2-(3,4-dihydro-2H-pyrrol-5-ylamino)-N-methylpropanamide (CID 10511338) is (2R)-2-(3,4-dihydro-2H-pyrrol-5-ylamino)-N-methylpropanamide.
What is the SMILES notation for (2R)-2-(3,4-dihydro-2H-pyrrol-5-ylamino)-N-methylpropanamide?
The canonical SMILES for (2R)-2-(3,4-dihydro-2H-pyrrol-5-ylamino)-N-methylpropanamide is CNC(=O)[C@@H](C)NC1=NCCC1.
What is the InChIKey of (2R)-2-(3,4-dihydro-2H-pyrrol-5-ylamino)-N-methylpropanamide?
The InChIKey is KFUMJFUGRPZNAQ-ZCFIWIBFSA-N. The full InChI is InChI=1S/C8H15N3O/c1-6(8(12)9-2)11-7-4-3-5-10-7/h6H,3-5H2,1-2H3,(H,9,12)(H,10,11)/t6-/m1/s1.
What are the key properties of (2R)-2-(3,4-dihydro-2H-pyrrol-5-ylamino)-N-methylpropanamide?
(2R)-2-(3,4-dihydro-2H-pyrrol-5-ylamino)-N-methylpropanamide has a molecular weight of 169.23 g/mol, XLogP of -0.10, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-(3,4-dihydro-2H-pyrrol-5-ylamino)-N-methylpropanamide is sourced from PubChem (CID 10511338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).