C16H16BrFO — CID 105113659
1-(5-bromo-2-fluorophenyl)-3-(2-methylphenyl)propan-1-ol (PubChem CID 105113659) has the molecular formula C16H16BrFO and a molecular weight of 323.21 g/mol. Its IUPAC name is 1-(5-bromo-2-fluorophenyl)-3-(2-methylphenyl)propan-1-ol.
| Compound Name | 1-(5-bromo-2-fluorophenyl)-3-(2-methylphenyl)propan-1-ol |
|---|---|
| PubChem CID | 105113659 |
| Molecular Formula | C16H16BrFO |
| Molecular Weight | 323.21 g/mol |
| Exact Mass | 322.04 |
| IUPAC Name | 1-(5-bromo-2-fluorophenyl)-3-(2-methylphenyl)propan-1-ol |
| SMILES | Cc1ccccc1CCC(O)c1cc(Br)ccc1F |
| InChI | InChI=1S/C16H16BrFO/c1-11-4-2-3-5-12(11)6-9-16(19)14-10-13(17)7-8-15(14)18/h2-5,7-8,10,16,19H,6,9H2,1H3 |
| InChIKey | JPNHCFSMBDUCOH-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.21 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |