C9H16O3 — CID 10511392
(E)-5,5-diethoxypent-2-enal (PubChem CID 10511392) has the molecular formula C9H16O3 and a molecular weight of 172.22 g/mol. Its IUPAC name is (E)-5,5-diethoxypent-2-enal.
| Compound Name | (E)-5,5-diethoxypent-2-enal |
|---|---|
| PubChem CID | 10511392 |
| Molecular Formula | C9H16O3 |
| Molecular Weight | 172.22 g/mol |
| Exact Mass | 172.11 |
| IUPAC Name | (E)-5,5-diethoxypent-2-enal |
| SMILES | CCOC(C/C=C/C=O)OCC |
| InChI | InChI=1S/C9H16O3/c1-3-11-9(12-4-2)7-5-6-8-10/h5-6,8-9H,3-4,7H2,1-2H3/b6-5+ |
| InChIKey | IYGRZVYVDHHSIB-AATRIKPKSA-N |
| XLogP | 1.53 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.22 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|