About 3-chloropropyl 3-oxobutanoate
3-chloropropyl 3-oxobutanoate (PubChem CID 10511540) has the molecular formula C7H11ClO3
and a molecular weight of 178.61 g/mol. Its IUPAC name is 3-chloropropyl 3-oxobutanoate.
Molecular Properties
| Compound Name | 3-chloropropyl 3-oxobutanoate |
| PubChem CID | 10511540 |
| Molecular Formula | C7H11ClO3 |
| Molecular Weight | 178.61 g/mol |
| Exact Mass | 178.04 |
| IUPAC Name | 3-chloropropyl 3-oxobutanoate |
| SMILES | CC(=O)CC(=O)OCCCCl |
| InChI | InChI=1S/C7H11ClO3/c1-6(9)5-7(10)11-4-2-3-8/h2-5H2,1H3 |
| InChIKey | PRMNESORVLFXBR-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.61 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-chloropropyl 3-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloropropyl 3-oxobutanoate?
The IUPAC name of 3-chloropropyl 3-oxobutanoate (CID 10511540) is 3-chloropropyl 3-oxobutanoate.
What is the SMILES notation for 3-chloropropyl 3-oxobutanoate?
The canonical SMILES for 3-chloropropyl 3-oxobutanoate is CC(=O)CC(=O)OCCCCl.
What is the InChIKey of 3-chloropropyl 3-oxobutanoate?
The InChIKey is PRMNESORVLFXBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11ClO3/c1-6(9)5-7(10)11-4-2-3-8/h2-5H2,1H3.
What are the key properties of 3-chloropropyl 3-oxobutanoate?
3-chloropropyl 3-oxobutanoate has a molecular weight of 178.61 g/mol, XLogP of 1.14, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloropropyl 3-oxobutanoate is sourced from PubChem (CID 10511540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).