C6H13NO3S — CID 10511554
(1R,2R,3S,4S,5R)-4-amino-5-methylsulfanylcyclopentane-1,2,3-triol (PubChem CID 10511554) has the molecular formula C6H13NO3S and a molecular weight of 179.24 g/mol. Its IUPAC name is (1R,2R,3S,4S,5R)-4-amino-5-methylsulfanylcyclopentane-1,2,3-triol.
| Compound Name | (1R,2R,3S,4S,5R)-4-amino-5-methylsulfanylcyclopentane-1,2,3-triol |
|---|---|
| PubChem CID | 10511554 |
| Molecular Formula | C6H13NO3S |
| Molecular Weight | 179.24 g/mol |
| Exact Mass | 179.06 |
| IUPAC Name | (1R,2R,3S,4S,5R)-4-amino-5-methylsulfanylcyclopentane-1,2,3-triol |
| SMILES | CS[C@@H]1[C@@H](N)[C@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C6H13NO3S/c1-11-6-2(7)3(8)4(9)5(6)10/h2-6,8-10H,7H2,1H3/t2-,3-,4+,5+,6+/m0/s1 |
| InChIKey | BLOFGONIVNXZME-HGVZOGFYSA-N |
| XLogP | -1.86 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.24 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |