C10H6N4 — CID 10511628
4,6-dimethylpyridine-2,3,5-tricarbonitrile (PubChem CID 10511628) has the molecular formula C10H6N4 and a molecular weight of 182.19 g/mol. Its IUPAC name is 4,6-dimethylpyridine-2,3,5-tricarbonitrile.
| Compound Name | 4,6-dimethylpyridine-2,3,5-tricarbonitrile |
|---|---|
| PubChem CID | 10511628 |
| Molecular Formula | C10H6N4 |
| Molecular Weight | 182.19 g/mol |
| Exact Mass | 182.06 |
| IUPAC Name | 4,6-dimethylpyridine-2,3,5-tricarbonitrile |
| SMILES | Cc1nc(C#N)c(C#N)c(C)c1C#N |
| InChI | InChI=1S/C10H6N4/c1-6-8(3-11)7(2)14-10(5-13)9(6)4-12/h1-2H3 |
| InChIKey | ZCJWVVQEHJTYMW-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 84.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.19 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |