About 1-(3-acetyl-5-methylidene-1,3-diazinan-1-yl)ethanone
1-(3-acetyl-5-methylidene-1,3-diazinan-1-yl)ethanone (PubChem CID 10511635) has the molecular formula C9H14N2O2
and a molecular weight of 182.22 g/mol. Its IUPAC name is 1-(3-acetyl-5-methylidene-1,3-diazinan-1-yl)ethanone.
Molecular Properties
| Compound Name | 1-(3-acetyl-5-methylidene-1,3-diazinan-1-yl)ethanone |
| PubChem CID | 10511635 |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | 1-(3-acetyl-5-methylidene-1,3-diazinan-1-yl)ethanone |
| SMILES | C=C1CN(C(C)=O)CN(C(C)=O)C1 |
| InChI | InChI=1S/C9H14N2O2/c1-7-4-10(8(2)12)6-11(5-7)9(3)13/h1,4-6H2,2-3H3 |
| InChIKey | HQVSPVVEQHFWAO-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-acetyl-5-methylidene-1,3-diazinan-1-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-acetyl-5-methylidene-1,3-diazinan-1-yl)ethanone?
The IUPAC name of 1-(3-acetyl-5-methylidene-1,3-diazinan-1-yl)ethanone (CID 10511635) is 1-(3-acetyl-5-methylidene-1,3-diazinan-1-yl)ethanone.
What is the SMILES notation for 1-(3-acetyl-5-methylidene-1,3-diazinan-1-yl)ethanone?
The canonical SMILES for 1-(3-acetyl-5-methylidene-1,3-diazinan-1-yl)ethanone is C=C1CN(C(C)=O)CN(C(C)=O)C1.
What is the InChIKey of 1-(3-acetyl-5-methylidene-1,3-diazinan-1-yl)ethanone?
The InChIKey is HQVSPVVEQHFWAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O2/c1-7-4-10(8(2)12)6-11(5-7)9(3)13/h1,4-6H2,2-3H3.
What are the key properties of 1-(3-acetyl-5-methylidene-1,3-diazinan-1-yl)ethanone?
1-(3-acetyl-5-methylidene-1,3-diazinan-1-yl)ethanone has a molecular weight of 182.22 g/mol, XLogP of 0.21, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-acetyl-5-methylidene-1,3-diazinan-1-yl)ethanone is sourced from PubChem (CID 10511635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).