C8H14N2O3 — CID 10511752
tert-butyl (4S)-2-oxoimidazolidine-4-carboxylate (PubChem CID 10511752) has the molecular formula C8H14N2O3 and a molecular weight of 186.21 g/mol. Its IUPAC name is tert-butyl (4S)-2-oxoimidazolidine-4-carboxylate.
| Compound Name | tert-butyl (4S)-2-oxoimidazolidine-4-carboxylate |
|---|---|
| PubChem CID | 10511752 |
| Molecular Formula | C8H14N2O3 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.10 |
| IUPAC Name | tert-butyl (4S)-2-oxoimidazolidine-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@@H]1CNC(=O)N1 |
| InChI | InChI=1S/C8H14N2O3/c1-8(2,3)13-6(11)5-4-9-7(12)10-5/h5H,4H2,1-3H3,(H2,9,10,12)/t5-/m0/s1 |
| InChIKey | QMQFQBITGIQPDH-YFKPBYRVSA-N |
| XLogP | 0.01 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |