C13H19NOS2 — CID 105118311
2-(4-tert-butyl-1,3-thiazol-2-yl)-1-(thiolan-3-yl)ethanone (PubChem CID 105118311) has the molecular formula C13H19NOS2 and a molecular weight of 269.43 g/mol. Its IUPAC name is 2-(4-tert-butyl-1,3-thiazol-2-yl)-1-(thiolan-3-yl)ethanone.
| Compound Name | 2-(4-tert-butyl-1,3-thiazol-2-yl)-1-(thiolan-3-yl)ethanone |
|---|---|
| PubChem CID | 105118311 |
| Molecular Formula | C13H19NOS2 |
| Molecular Weight | 269.43 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | 2-(4-tert-butyl-1,3-thiazol-2-yl)-1-(thiolan-3-yl)ethanone |
| SMILES | CC(C)(C)c1csc(CC(=O)C2CCSC2)n1 |
| InChI | InChI=1S/C13H19NOS2/c1-13(2,3)11-8-17-12(14-11)6-10(15)9-4-5-16-7-9/h8-9H,4-7H2,1-3H3 |
| InChIKey | VIKQSXYZUDDQLV-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.43 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |