About N-ethyl-5-pyridin-4-yl-1,3,4-oxadiazol-2-amine
N-ethyl-5-pyridin-4-yl-1,3,4-oxadiazol-2-amine (PubChem CID 10511869) has the molecular formula C9H10N4O
and a molecular weight of 190.21 g/mol. Its IUPAC name is N-ethyl-5-pyridin-4-yl-1,3,4-oxadiazol-2-amine.
Molecular Properties
| Compound Name | N-ethyl-5-pyridin-4-yl-1,3,4-oxadiazol-2-amine |
| PubChem CID | 10511869 |
| Molecular Formula | C9H10N4O |
| Molecular Weight | 190.21 g/mol |
| Exact Mass | 190.09 |
| IUPAC Name | N-ethyl-5-pyridin-4-yl-1,3,4-oxadiazol-2-amine |
| SMILES | CCNc1nnc(-c2ccncc2)o1 |
| InChI | InChI=1S/C9H10N4O/c1-2-11-9-13-12-8(14-9)7-3-5-10-6-4-7/h3-6H,2H2,1H3,(H,11,13) |
| InChIKey | PTKHLFYWWAHSRG-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 63.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.21 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-ethyl-5-pyridin-4-yl-1,3,4-oxadiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-5-pyridin-4-yl-1,3,4-oxadiazol-2-amine?
The IUPAC name of N-ethyl-5-pyridin-4-yl-1,3,4-oxadiazol-2-amine (CID 10511869) is N-ethyl-5-pyridin-4-yl-1,3,4-oxadiazol-2-amine.
What is the SMILES notation for N-ethyl-5-pyridin-4-yl-1,3,4-oxadiazol-2-amine?
The canonical SMILES for N-ethyl-5-pyridin-4-yl-1,3,4-oxadiazol-2-amine is CCNc1nnc(-c2ccncc2)o1.
What is the InChIKey of N-ethyl-5-pyridin-4-yl-1,3,4-oxadiazol-2-amine?
The InChIKey is PTKHLFYWWAHSRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N4O/c1-2-11-9-13-12-8(14-9)7-3-5-10-6-4-7/h3-6H,2H2,1H3,(H,11,13).
What are the key properties of N-ethyl-5-pyridin-4-yl-1,3,4-oxadiazol-2-amine?
N-ethyl-5-pyridin-4-yl-1,3,4-oxadiazol-2-amine has a molecular weight of 190.21 g/mol, XLogP of 1.56, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-5-pyridin-4-yl-1,3,4-oxadiazol-2-amine is sourced from PubChem (CID 10511869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).