About 6-(aminomethyl)pteridine-2,4-diamine
6-(aminomethyl)pteridine-2,4-diamine (PubChem CID 10511905) has the molecular formula C7H9N7
and a molecular weight of 191.20 g/mol. Its IUPAC name is 6-(aminomethyl)pteridine-2,4-diamine.
Molecular Properties
| Compound Name | 6-(aminomethyl)pteridine-2,4-diamine |
| PubChem CID | 10511905 |
| Molecular Formula | C7H9N7 |
| Molecular Weight | 191.20 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | 6-(aminomethyl)pteridine-2,4-diamine |
| SMILES | NCc1cnc2nc(N)nc(N)c2n1 |
| InChI | InChI=1S/C7H9N7/c8-1-3-2-11-6-4(12-3)5(9)13-7(10)14-6/h2H,1,8H2,(H4,9,10,11,13,14) |
| InChIKey | XBEUQVLNPDEQKL-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 129.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.20 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 6-(aminomethyl)pteridine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(aminomethyl)pteridine-2,4-diamine?
The IUPAC name of 6-(aminomethyl)pteridine-2,4-diamine (CID 10511905) is 6-(aminomethyl)pteridine-2,4-diamine.
What is the SMILES notation for 6-(aminomethyl)pteridine-2,4-diamine?
The canonical SMILES for 6-(aminomethyl)pteridine-2,4-diamine is NCc1cnc2nc(N)nc(N)c2n1.
What is the InChIKey of 6-(aminomethyl)pteridine-2,4-diamine?
The InChIKey is XBEUQVLNPDEQKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N7/c8-1-3-2-11-6-4(12-3)5(9)13-7(10)14-6/h2H,1,8H2,(H4,9,10,11,13,14).
What are the key properties of 6-(aminomethyl)pteridine-2,4-diamine?
6-(aminomethyl)pteridine-2,4-diamine has a molecular weight of 191.20 g/mol, XLogP of -0.96, 1 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(aminomethyl)pteridine-2,4-diamine is sourced from PubChem (CID 10511905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).