C11H19N3O — CID 105119199
4-methoxy-N,3-dimethyl-1-pyrimidin-5-ylbutan-1-amine (PubChem CID 105119199) has the molecular formula C11H19N3O and a molecular weight of 209.29 g/mol. Its IUPAC name is 4-methoxy-N,3-dimethyl-1-pyrimidin-5-ylbutan-1-amine.
| Compound Name | 4-methoxy-N,3-dimethyl-1-pyrimidin-5-ylbutan-1-amine |
|---|---|
| PubChem CID | 105119199 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | 4-methoxy-N,3-dimethyl-1-pyrimidin-5-ylbutan-1-amine |
| SMILES | CNC(CC(C)COC)c1cncnc1 |
| InChI | InChI=1S/C11H19N3O/c1-9(7-15-3)4-11(12-2)10-5-13-8-14-6-10/h5-6,8-9,11-12H,4,7H2,1-3H3 |
| InChIKey | JFXFZDKKLSFWEE-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |