C14H20FNO2S — CID 105119761
2-(1,1-dioxothiolan-3-yl)-N-ethyl-1-(2-fluorophenyl)ethanamine (PubChem CID 105119761) has the molecular formula C14H20FNO2S and a molecular weight of 285.38 g/mol. Its IUPAC name is 2-(1,1-dioxothiolan-3-yl)-N-ethyl-1-(2-fluorophenyl)ethanamine.
| Compound Name | 2-(1,1-dioxothiolan-3-yl)-N-ethyl-1-(2-fluorophenyl)ethanamine |
|---|---|
| PubChem CID | 105119761 |
| Molecular Formula | C14H20FNO2S |
| Molecular Weight | 285.38 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 2-(1,1-dioxothiolan-3-yl)-N-ethyl-1-(2-fluorophenyl)ethanamine |
| SMILES | CCNC(CC1CCS(=O)(=O)C1)c1ccccc1F |
| InChI | InChI=1S/C14H20FNO2S/c1-2-16-14(12-5-3-4-6-13(12)15)9-11-7-8-19(17,18)10-11/h3-6,11,14,16H,2,7-10H2,1H3 |
| InChIKey | NRAWMIYDZWFHLH-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.38 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |