About N-(6-deuterio-1-hydroxy-2-pyridinylidene)-2,2-dimethylpropanamide
N-(6-deuterio-1-hydroxy-2-pyridinylidene)-2,2-dimethylpropanamide (PubChem CID 10512053) has the molecular formula C10H14N2O2
and a molecular weight of 195.24 g/mol. Its IUPAC name is N-(6-deuterio-1-hydroxy-2-pyridinylidene)-2,2-dimethylpropanamide.
Molecular Properties
| Compound Name | N-(6-deuterio-1-hydroxy-2-pyridinylidene)-2,2-dimethylpropanamide |
| PubChem CID | 10512053 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 195.24 g/mol |
| Exact Mass | 195.11 |
| IUPAC Name | N-(6-deuterio-1-hydroxy-2-pyridinylidene)-2,2-dimethylpropanamide |
| SMILES | [2H]c1ccc/c(=N\C(=O)C(C)(C)C)n1O |
| InChI | InChI=1S/C10H14N2O2/c1-10(2,3)9(13)11-8-6-4-5-7-12(8)14/h4-7,14H,1-3H3/b11-8+/i7D |
| InChIKey | HFYMECACXRAWNU-IOMZFSQSSA-N |
| XLogP | 1.20 |
| TPSA | 54.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.24 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|
Analyze N-(6-deuterio-1-hydroxy-2-pyridinylidene)-2,2-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6-deuterio-1-hydroxy-2-pyridinylidene)-2,2-dimethylpropanamide?
The IUPAC name of N-(6-deuterio-1-hydroxy-2-pyridinylidene)-2,2-dimethylpropanamide (CID 10512053) is N-(6-deuterio-1-hydroxy-2-pyridinylidene)-2,2-dimethylpropanamide.
What is the SMILES notation for N-(6-deuterio-1-hydroxy-2-pyridinylidene)-2,2-dimethylpropanamide?
The canonical SMILES for N-(6-deuterio-1-hydroxy-2-pyridinylidene)-2,2-dimethylpropanamide is [2H]c1ccc/c(=N\C(=O)C(C)(C)C)n1O.
What is the InChIKey of N-(6-deuterio-1-hydroxy-2-pyridinylidene)-2,2-dimethylpropanamide?
The InChIKey is HFYMECACXRAWNU-IOMZFSQSSA-N. The full InChI is InChI=1S/C10H14N2O2/c1-10(2,3)9(13)11-8-6-4-5-7-12(8)14/h4-7,14H,1-3H3/b11-8+/i7D.
What are the key properties of N-(6-deuterio-1-hydroxy-2-pyridinylidene)-2,2-dimethylpropanamide?
N-(6-deuterio-1-hydroxy-2-pyridinylidene)-2,2-dimethylpropanamide has a molecular weight of 195.24 g/mol, XLogP of 1.20, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6-deuterio-1-hydroxy-2-pyridinylidene)-2,2-dimethylpropanamide is sourced from PubChem (CID 10512053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).