About trimethyl(4-pyrrolidin-1-ylbuta-1,2-dienyl)silane
trimethyl(4-pyrrolidin-1-ylbuta-1,2-dienyl)silane (PubChem CID 10512064) has the molecular formula C11H21NSi
and a molecular weight of 195.38 g/mol. Its IUPAC name is trimethyl(4-pyrrolidin-1-ylbuta-1,2-dienyl)silane.
Molecular Properties
| Compound Name | trimethyl(4-pyrrolidin-1-ylbuta-1,2-dienyl)silane |
| PubChem CID | 10512064 |
| Molecular Formula | C11H21NSi |
| Molecular Weight | 195.38 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | trimethyl(4-pyrrolidin-1-ylbuta-1,2-dienyl)silane |
| SMILES | C[Si](C)(C)C=C=CCN1CCCC1 |
| InChI | InChI=1S/C11H21NSi/c1-13(2,3)11-7-6-10-12-8-4-5-9-12/h6,11H,4-5,8-10H2,1-3H3 |
| InChIKey | CUCPHSORIYYTOX-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.38 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze trimethyl(4-pyrrolidin-1-ylbuta-1,2-dienyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl(4-pyrrolidin-1-ylbuta-1,2-dienyl)silane?
The IUPAC name of trimethyl(4-pyrrolidin-1-ylbuta-1,2-dienyl)silane (CID 10512064) is trimethyl(4-pyrrolidin-1-ylbuta-1,2-dienyl)silane.
What is the SMILES notation for trimethyl(4-pyrrolidin-1-ylbuta-1,2-dienyl)silane?
The canonical SMILES for trimethyl(4-pyrrolidin-1-ylbuta-1,2-dienyl)silane is C[Si](C)(C)C=C=CCN1CCCC1.
What is the InChIKey of trimethyl(4-pyrrolidin-1-ylbuta-1,2-dienyl)silane?
The InChIKey is CUCPHSORIYYTOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NSi/c1-13(2,3)11-7-6-10-12-8-4-5-9-12/h6,11H,4-5,8-10H2,1-3H3.
What are the key properties of trimethyl(4-pyrrolidin-1-ylbuta-1,2-dienyl)silane?
trimethyl(4-pyrrolidin-1-ylbuta-1,2-dienyl)silane has a molecular weight of 195.38 g/mol, XLogP of 2.67, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl(4-pyrrolidin-1-ylbuta-1,2-dienyl)silane is sourced from PubChem (CID 10512064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).