C18H24N2 — CID 105121222
4-pyridin-3-yl-1-(2,4,6-trimethylphenyl)butan-2-amine (PubChem CID 105121222) has the molecular formula C18H24N2 and a molecular weight of 268.40 g/mol. Its IUPAC name is 4-pyridin-3-yl-1-(2,4,6-trimethylphenyl)butan-2-amine.
| Compound Name | 4-pyridin-3-yl-1-(2,4,6-trimethylphenyl)butan-2-amine |
|---|---|
| PubChem CID | 105121222 |
| Molecular Formula | C18H24N2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | 4-pyridin-3-yl-1-(2,4,6-trimethylphenyl)butan-2-amine |
| SMILES | Cc1cc(C)c(CC(N)CCc2cccnc2)c(C)c1 |
| InChI | InChI=1S/C18H24N2/c1-13-9-14(2)18(15(3)10-13)11-17(19)7-6-16-5-4-8-20-12-16/h4-5,8-10,12,17H,6-7,11,19H2,1-3H3 |
| InChIKey | ZUVSWXIRWHYZSD-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |