About 2-[(E)-4,4-dimethoxy-3-methylbut-2-enyl]-1,3-dioxolane
2-[(E)-4,4-dimethoxy-3-methylbut-2-enyl]-1,3-dioxolane (PubChem CID 10512292) has the molecular formula C10H18O4
and a molecular weight of 202.25 g/mol. Its IUPAC name is 2-[(E)-4,4-dimethoxy-3-methylbut-2-enyl]-1,3-dioxolane.
Molecular Properties
| Compound Name | 2-[(E)-4,4-dimethoxy-3-methylbut-2-enyl]-1,3-dioxolane |
| PubChem CID | 10512292 |
| Molecular Formula | C10H18O4 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | 2-[(E)-4,4-dimethoxy-3-methylbut-2-enyl]-1,3-dioxolane |
| SMILES | COC(OC)/C(C)=C/CC1OCCO1 |
| InChI | InChI=1S/C10H18O4/c1-8(10(11-2)12-3)4-5-9-13-6-7-14-9/h4,9-10H,5-7H2,1-3H3/b8-4+ |
| InChIKey | LNHKWSHCMWTBGK-XBXARRHUSA-N |
| XLogP | 1.31 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(E)-4,4-dimethoxy-3-methylbut-2-enyl]-1,3-dioxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E)-4,4-dimethoxy-3-methylbut-2-enyl]-1,3-dioxolane?
The IUPAC name of 2-[(E)-4,4-dimethoxy-3-methylbut-2-enyl]-1,3-dioxolane (CID 10512292) is 2-[(E)-4,4-dimethoxy-3-methylbut-2-enyl]-1,3-dioxolane.
What is the SMILES notation for 2-[(E)-4,4-dimethoxy-3-methylbut-2-enyl]-1,3-dioxolane?
The canonical SMILES for 2-[(E)-4,4-dimethoxy-3-methylbut-2-enyl]-1,3-dioxolane is COC(OC)/C(C)=C/CC1OCCO1.
What is the InChIKey of 2-[(E)-4,4-dimethoxy-3-methylbut-2-enyl]-1,3-dioxolane?
The InChIKey is LNHKWSHCMWTBGK-XBXARRHUSA-N. The full InChI is InChI=1S/C10H18O4/c1-8(10(11-2)12-3)4-5-9-13-6-7-14-9/h4,9-10H,5-7H2,1-3H3/b8-4+.
What are the key properties of 2-[(E)-4,4-dimethoxy-3-methylbut-2-enyl]-1,3-dioxolane?
2-[(E)-4,4-dimethoxy-3-methylbut-2-enyl]-1,3-dioxolane has a molecular weight of 202.25 g/mol, XLogP of 1.31, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E)-4,4-dimethoxy-3-methylbut-2-enyl]-1,3-dioxolane is sourced from PubChem (CID 10512292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).